# Tutorial 04 - Safe Globals ## tl;dr - A pseudo-lock is introduced. - It is a first showcase of OS synchronization primitives and enables safe access to a global data structure. ## Mutable globals in Rust When we introduced the globally usable `print!` macros in [tutorial 03], we cheated a bit. Calling `core::fmt`'s `write_fmt()` function, which takes an `&mut self`, was only working because on each call, a new instance of `QEMUOutput` was created. If we would want to preserve some state, e.g. statistics about the number of characters written, we need to make a single global instance of `QEMUOutput` (in Rust, using the `static` keyword). A `static QEMU_OUTPUT`, however, would not allow to call functions taking `&mut self`. For that, we would need a `static mut`, but calling functions that mutate state on `static mut`s is unsafe. The Rust compiler's reasoning for this is that it can then not prevent anymore that multiple cores/threads are mutating the data concurrently (it is a global, so everyone can reference it from anywhere. The borrow checker can't help here). The solution to this problem is to wrap the global into a synchronization primitive. In our case, a variant of a *MUTual EXclusion* primitive. `Mutex` is introduced as a trait in `synchronization.rs`, and implemented by the `NullLock` in the same file. In order to make the code lean for teaching purposes, it leaves out the actual architecture-specific logic for protection against concurrent access, since we don't need it as long as the kernel only executes on a single core with interrupts disabled. The `NullLock` focuses on showcasing the Rust core concept of [interior mutability]. Make sure to read up on it. I also recommend to read this article about an [accurate mental model for Rust's reference types]. If you want to compare the `NullLock` to some real-world mutex implementations, you can check out implemntations in the [spin crate] or the [parking lot crate]. [tutorial 03]: ../03_hacky_hello_world [interior mutability]: https://doc.rust-lang.org/std/cell/index.html [accurate mental model for Rust's reference types]: https://docs.rs/dtolnay/0.0.6/dtolnay/macro._02__reference_types.html [spin crate]: https://github.com/mvdnes/spin-rs [parking lot crate]: https://github.com/Amanieu/parking_lot ## Test it ```console $ make qemu [...] [0] Hello from Rust! [1] Chars written: 22 [2] Stopping here. ``` ## Diff to previous ```diff diff -uNr 03_hacky_hello_world/Cargo.toml 04_safe_globals/Cargo.toml --- 03_hacky_hello_world/Cargo.toml +++ 04_safe_globals/Cargo.toml @@ -1,6 +1,6 @@ [package] name = "mingo" -version = "0.3.0" +version = "0.4.0" authors = ["Andre Richter "] edition = "2021" diff -uNr 03_hacky_hello_world/src/bsp/raspberrypi/console.rs 04_safe_globals/src/bsp/raspberrypi/console.rs --- 03_hacky_hello_world/src/bsp/raspberrypi/console.rs +++ 04_safe_globals/src/bsp/raspberrypi/console.rs @@ -4,7 +4,7 @@ //! BSP console facilities. -use crate::console; +use crate::{console, synchronization, synchronization::NullLock}; use core::fmt; //-------------------------------------------------------------------------------------------------- @@ -12,25 +12,64 @@ //-------------------------------------------------------------------------------------------------- /// A mystical, magical device for generating QEMU output out of the void. -struct QEMUOutput; +/// +/// The mutex protected part. +struct QEMUOutputInner { + chars_written: usize, +} + +//-------------------------------------------------------------------------------------------------- +// Public Definitions +//-------------------------------------------------------------------------------------------------- + +/// The main struct. +pub struct QEMUOutput { + inner: NullLock, +} + +//-------------------------------------------------------------------------------------------------- +// Global instances +//-------------------------------------------------------------------------------------------------- + +static QEMU_OUTPUT: QEMUOutput = QEMUOutput::new(); //-------------------------------------------------------------------------------------------------- // Private Code //-------------------------------------------------------------------------------------------------- +impl QEMUOutputInner { + const fn new() -> QEMUOutputInner { + QEMUOutputInner { chars_written: 0 } + } + + /// Send a character. + fn write_char(&mut self, c: char) { + unsafe { + core::ptr::write_volatile(0x3F20_1000 as *mut u8, c as u8); + } + + self.chars_written += 1; + } +} + /// Implementing `core::fmt::Write` enables usage of the `format_args!` macros, which in turn are /// used to implement the `kernel`'s `print!` and `println!` macros. By implementing `write_str()`, /// we get `write_fmt()` automatically. /// +/// The function takes an `&mut self`, so it must be implemented for the inner struct. +/// /// See [`src/print.rs`]. /// /// [`src/print.rs`]: ../../print/index.html -impl fmt::Write for QEMUOutput { +impl fmt::Write for QEMUOutputInner { fn write_str(&mut self, s: &str) -> fmt::Result { for c in s.chars() { - unsafe { - core::ptr::write_volatile(0x3F20_1000 as *mut u8, c as u8); + // Convert newline to carrige return + newline. + if c == '\n' { + self.write_char('\r') } + + self.write_char(c); } Ok(()) @@ -41,7 +80,37 @@ // Public Code //-------------------------------------------------------------------------------------------------- +impl QEMUOutput { + /// Create a new instance. + pub const fn new() -> QEMUOutput { + QEMUOutput { + inner: NullLock::new(QEMUOutputInner::new()), + } + } +} + /// Return a reference to the console. -pub fn console() -> impl console::interface::Write { - QEMUOutput {} +pub fn console() -> &'static impl console::interface::All { + &QEMU_OUTPUT +} + +//------------------------------------------------------------------------------ +// OS Interface Code +//------------------------------------------------------------------------------ +use synchronization::interface::Mutex; + +/// Passthrough of `args` to the `core::fmt::Write` implementation, but guarded by a Mutex to +/// serialize access. +impl console::interface::Write for QEMUOutput { + fn write_fmt(&self, args: core::fmt::Arguments) -> fmt::Result { + // Fully qualified syntax for the call to `core::fmt::Write::write:fmt()` to increase + // readability. + self.inner.lock(|inner| fmt::Write::write_fmt(inner, args)) + } +} + +impl console::interface::Statistics for QEMUOutput { + fn chars_written(&self) -> usize { + self.inner.lock(|inner| inner.chars_written) + } } diff -uNr 03_hacky_hello_world/src/console.rs 04_safe_globals/src/console.rs --- 03_hacky_hello_world/src/console.rs +++ 04_safe_globals/src/console.rs @@ -10,10 +10,22 @@ /// Console interfaces. pub mod interface { + use core::fmt; + /// Console write functions. - /// - /// `core::fmt::Write` is exactly what we need for now. Re-export it here because - /// implementing `console::Write` gives a better hint to the reader about the - /// intention. - pub use core::fmt::Write; + pub trait Write { + /// Write a Rust format string. + fn write_fmt(&self, args: fmt::Arguments) -> fmt::Result; + } + + /// Console statistics. + pub trait Statistics { + /// Return the number of characters written. + fn chars_written(&self) -> usize { + 0 + } + } + + /// Trait alias for a full-fledged console. + pub trait All = Write + Statistics; } diff -uNr 03_hacky_hello_world/src/main.rs 04_safe_globals/src/main.rs --- 03_hacky_hello_world/src/main.rs +++ 04_safe_globals/src/main.rs @@ -106,6 +106,7 @@ #![feature(format_args_nl)] #![feature(panic_info_message)] +#![feature(trait_alias)] #![no_main] #![no_std] @@ -114,6 +115,7 @@ mod cpu; mod panic_wait; mod print; +mod synchronization; /// Early init code. /// @@ -121,7 +123,15 @@ /// /// - Only a single core must be active and running this function. unsafe fn kernel_init() -> ! { + use console::interface::Statistics; + println!("[0] Hello from Rust!"); - panic!("Stopping here.") + println!( + "[1] Chars written: {}", + bsp::console::console().chars_written() + ); + + println!("[2] Stopping here."); + cpu::wait_forever() } diff -uNr 03_hacky_hello_world/src/synchronization.rs 04_safe_globals/src/synchronization.rs --- 03_hacky_hello_world/src/synchronization.rs +++ 04_safe_globals/src/synchronization.rs @@ -0,0 +1,77 @@ +// SPDX-License-Identifier: MIT OR Apache-2.0 +// +// Copyright (c) 2020-2022 Andre Richter + +//! Synchronization primitives. +//! +//! # Resources +//! +//! - +//! - +//! - + +use core::cell::UnsafeCell; + +//-------------------------------------------------------------------------------------------------- +// Public Definitions +//-------------------------------------------------------------------------------------------------- + +/// Synchronization interfaces. +pub mod interface { + + /// Any object implementing this trait guarantees exclusive access to the data wrapped within + /// the Mutex for the duration of the provided closure. + pub trait Mutex { + /// The type of the data that is wrapped by this mutex. + type Data; + + /// Locks the mutex and grants the closure temporary mutable access to the wrapped data. + fn lock(&self, f: impl FnOnce(&mut Self::Data) -> R) -> R; + } +} + +/// A pseudo-lock for teaching purposes. +/// +/// In contrast to a real Mutex implementation, does not protect against concurrent access from +/// other cores to the contained data. This part is preserved for later lessons. +/// +/// The lock will only be used as long as it is safe to do so, i.e. as long as the kernel is +/// executing single-threaded, aka only running on a single core with interrupts disabled. +pub struct NullLock +where + T: ?Sized, +{ + data: UnsafeCell, +} + +//-------------------------------------------------------------------------------------------------- +// Public Code +//-------------------------------------------------------------------------------------------------- + +unsafe impl Send for NullLock where T: ?Sized + Send {} +unsafe impl Sync for NullLock where T: ?Sized + Send {} + +impl NullLock { + /// Create an instance. + pub const fn new(data: T) -> Self { + Self { + data: UnsafeCell::new(data), + } + } +} + +//------------------------------------------------------------------------------ +// OS Interface Code +//------------------------------------------------------------------------------ + +impl interface::Mutex for NullLock { + type Data = T; + + fn lock(&self, f: impl FnOnce(&mut Self::Data) -> R) -> R { + // In a real lock, there would be code encapsulating this line that ensures that this + // mutable reference will ever only be given out once at a time. + let data = unsafe { &mut *self.data.get() }; + + f(data) + } +} ```