|
|
|
# Tutorial 04 - Safe Globals
|
|
|
|
|
|
|
|
## tl;dr
|
|
|
|
|
|
|
|
- A pseudo-lock is introduced.
|
|
|
|
- It is a first showcase of OS synchronization primitives and enables safe access to a global data
|
|
|
|
structure.
|
|
|
|
|
|
|
|
## Mutable globals in Rust
|
|
|
|
|
|
|
|
When we introduced the globally usable `print!` macros in [tutorial 03], we cheated a bit. Calling
|
|
|
|
`core::fmt`'s `write_fmt()` function, which takes an `&mut self`, was only working because on each
|
|
|
|
call, a new instance of `QEMUOutput` was created.
|
|
|
|
|
|
|
|
If we would want to preserve some state, e.g. statistics about the number of characters written, we
|
|
|
|
need to make a single global instance of `QEMUOutput` (in Rust, using the `static` keyword).
|
|
|
|
|
|
|
|
A `static QEMU_OUTPUT`, however, would not allow to call functions taking `&mut self`. For that, we
|
|
|
|
would need a `static mut`, but calling functions that mutate state on `static mut`s is unsafe. The
|
|
|
|
Rust compiler's reasoning for this is that it can then not prevent anymore that multiple
|
|
|
|
cores/threads are mutating the data concurrently (it is a global, so everyone can reference it from
|
|
|
|
anywhere. The borrow checker can't help here).
|
|
|
|
|
|
|
|
The solution to this problem is to wrap the global into a synchronization primitive. In our case, a
|
|
|
|
variant of a *MUTual EXclusion* primitive. `Mutex` is introduced as a trait in `synchronization.rs`,
|
|
|
|
and implemented by the `NullLock` in the same file. In order to make the code lean for teaching
|
|
|
|
purposes, it leaves out the actual architecture-specific logic for protection against concurrent
|
|
|
|
access, since we don't need it as long as the kernel only executes on a single core with interrupts
|
|
|
|
disabled.
|
|
|
|
|
|
|
|
The `NullLock` focuses on showcasing the Rust core concept of [interior mutability]. Make sure to
|
|
|
|
read up on it. I also recommend to read this article about an [accurate mental model for Rust's
|
|
|
|
reference types].
|
|
|
|
|
|
|
|
If you want to compare the `NullLock` to some real-world mutex implementations, you can check out
|
|
|
|
implemntations in the [spin crate] or the [parking lot crate].
|
|
|
|
|
|
|
|
[tutorial 03]: ../03_hacky_hello_world
|
|
|
|
[interior mutability]: https://doc.rust-lang.org/std/cell/index.html
|
|
|
|
[accurate mental model for Rust's reference types]: https://docs.rs/dtolnay/0.0.6/dtolnay/macro._02__reference_types.html
|
|
|
|
[spin crate]: https://github.com/mvdnes/spin-rs
|
|
|
|
[parking lot crate]: https://github.com/Amanieu/parking_lot
|
|
|
|
|
|
|
|
## Test it
|
|
|
|
|
|
|
|
```console
|
|
|
|
$ make qemu
|
|
|
|
[...]
|
|
|
|
|
|
|
|
[0] Hello from Rust!
|
|
|
|
[1] Chars written: 22
|
|
|
|
[2] Stopping here.
|
|
|
|
```
|
|
|
|
|
|
|
|
## Diff to previous
|
|
|
|
```diff
|
|
|
|
|
|
|
|
diff -uNr 03_hacky_hello_world/Cargo.toml 04_safe_globals/Cargo.toml
|
|
|
|
--- 03_hacky_hello_world/Cargo.toml
|
|
|
|
+++ 04_safe_globals/Cargo.toml
|
|
|
|
@@ -1,6 +1,6 @@
|
|
|
|
[package]
|
|
|
|
name = "mingo"
|
|
|
|
-version = "0.3.0"
|
|
|
|
+version = "0.4.0"
|
|
|
|
authors = ["Andre Richter <andre.o.richter@gmail.com>"]
|
|
|
|
edition = "2021"
|
|
|
|
|
|
|
|
|
|
|
|
diff -uNr 03_hacky_hello_world/src/bsp/raspberrypi/console.rs 04_safe_globals/src/bsp/raspberrypi/console.rs
|
|
|
|
--- 03_hacky_hello_world/src/bsp/raspberrypi/console.rs
|
|
|
|
+++ 04_safe_globals/src/bsp/raspberrypi/console.rs
|
|
|
|
@@ -4,7 +4,7 @@
|
|
|
|
|
|
|
|
//! BSP console facilities.
|
|
|
|
|
|
|
|
-use crate::console;
|
|
|
|
+use crate::{console, synchronization, synchronization::NullLock};
|
|
|
|
use core::fmt;
|
|
|
|
|
|
|
|
//--------------------------------------------------------------------------------------------------
|
|
|
|
@@ -12,25 +12,64 @@
|
|
|
|
//--------------------------------------------------------------------------------------------------
|
|
|
|
|
|
|
|
/// A mystical, magical device for generating QEMU output out of the void.
|
|
|
|
-struct QEMUOutput;
|
|
|
|
+///
|
|
|
|
+/// The mutex protected part.
|
|
|
|
+struct QEMUOutputInner {
|
|
|
|
+ chars_written: usize,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+//--------------------------------------------------------------------------------------------------
|
|
|
|
+// Public Definitions
|
|
|
|
+//--------------------------------------------------------------------------------------------------
|
|
|
|
+
|
|
|
|
+/// The main struct.
|
|
|
|
+pub struct QEMUOutput {
|
|
|
|
+ inner: NullLock<QEMUOutputInner>,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+//--------------------------------------------------------------------------------------------------
|
|
|
|
+// Global instances
|
|
|
|
+//--------------------------------------------------------------------------------------------------
|
|
|
|
+
|
|
|
|
+static QEMU_OUTPUT: QEMUOutput = QEMUOutput::new();
|
|
|
|
|
|
|
|
//--------------------------------------------------------------------------------------------------
|
|
|
|
// Private Code
|
|
|
|
//--------------------------------------------------------------------------------------------------
|
|
|
|
|
|
|
|
+impl QEMUOutputInner {
|
|
|
|
+ const fn new() -> QEMUOutputInner {
|
|
|
|
+ QEMUOutputInner { chars_written: 0 }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /// Send a character.
|
|
|
|
+ fn write_char(&mut self, c: char) {
|
|
|
|
+ unsafe {
|
|
|
|
+ core::ptr::write_volatile(0x3F20_1000 as *mut u8, c as u8);
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ self.chars_written += 1;
|
|
|
|
+ }
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
/// Implementing `core::fmt::Write` enables usage of the `format_args!` macros, which in turn are
|
|
|
|
/// used to implement the `kernel`'s `print!` and `println!` macros. By implementing `write_str()`,
|
|
|
|
/// we get `write_fmt()` automatically.
|
|
|
|
///
|
|
|
|
+/// The function takes an `&mut self`, so it must be implemented for the inner struct.
|
|
|
|
+///
|
|
|
|
/// See [`src/print.rs`].
|
|
|
|
///
|
|
|
|
/// [`src/print.rs`]: ../../print/index.html
|
|
|
|
-impl fmt::Write for QEMUOutput {
|
|
|
|
+impl fmt::Write for QEMUOutputInner {
|
|
|
|
fn write_str(&mut self, s: &str) -> fmt::Result {
|
|
|
|
for c in s.chars() {
|
|
|
|
- unsafe {
|
|
|
|
- core::ptr::write_volatile(0x3F20_1000 as *mut u8, c as u8);
|
|
|
|
+ // Convert newline to carrige return + newline.
|
|
|
|
+ if c == '\n' {
|
|
|
|
+ self.write_char('\r')
|
|
|
|
}
|
|
|
|
+
|
|
|
|
+ self.write_char(c);
|
|
|
|
}
|
|
|
|
|
|
|
|
Ok(())
|
|
|
|
@@ -41,7 +80,37 @@
|
|
|
|
// Public Code
|
|
|
|
//--------------------------------------------------------------------------------------------------
|
|
|
|
|
|
|
|
+impl QEMUOutput {
|
|
|
|
+ /// Create a new instance.
|
|
|
|
+ pub const fn new() -> QEMUOutput {
|
|
|
|
+ QEMUOutput {
|
|
|
|
+ inner: NullLock::new(QEMUOutputInner::new()),
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
/// Return a reference to the console.
|
|
|
|
-pub fn console() -> impl console::interface::Write {
|
|
|
|
- QEMUOutput {}
|
|
|
|
+pub fn console() -> &'static impl console::interface::All {
|
|
|
|
+ &QEMU_OUTPUT
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+//------------------------------------------------------------------------------
|
|
|
|
+// OS Interface Code
|
|
|
|
+//------------------------------------------------------------------------------
|
|
|
|
+use synchronization::interface::Mutex;
|
|
|
|
+
|
|
|
|
+/// Passthrough of `args` to the `core::fmt::Write` implementation, but guarded by a Mutex to
|
|
|
|
+/// serialize access.
|
|
|
|
+impl console::interface::Write for QEMUOutput {
|
|
|
|
+ fn write_fmt(&self, args: core::fmt::Arguments) -> fmt::Result {
|
|
|
|
+ // Fully qualified syntax for the call to `core::fmt::Write::write:fmt()` to increase
|
|
|
|
+ // readability.
|
|
|
|
+ self.inner.lock(|inner| fmt::Write::write_fmt(inner, args))
|
|
|
|
+ }
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+impl console::interface::Statistics for QEMUOutput {
|
|
|
|
+ fn chars_written(&self) -> usize {
|
|
|
|
+ self.inner.lock(|inner| inner.chars_written)
|
|
|
|
+ }
|
|
|
|
}
|
|
|
|
|
|
|
|
diff -uNr 03_hacky_hello_world/src/console.rs 04_safe_globals/src/console.rs
|
|
|
|
--- 03_hacky_hello_world/src/console.rs
|
|
|
|
+++ 04_safe_globals/src/console.rs
|
|
|
|
@@ -10,10 +10,22 @@
|
|
|
|
|
|
|
|
/// Console interfaces.
|
|
|
|
pub mod interface {
|
|
|
|
+ use core::fmt;
|
|
|
|
+
|
|
|
|
/// Console write functions.
|
|
|
|
- ///
|
|
|
|
- /// `core::fmt::Write` is exactly what we need for now. Re-export it here because
|
|
|
|
- /// implementing `console::Write` gives a better hint to the reader about the
|
|
|
|
- /// intention.
|
|
|
|
- pub use core::fmt::Write;
|
|
|
|
+ pub trait Write {
|
|
|
|
+ /// Write a Rust format string.
|
|
|
|
+ fn write_fmt(&self, args: fmt::Arguments) -> fmt::Result;
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /// Console statistics.
|
|
|
|
+ pub trait Statistics {
|
|
|
|
+ /// Return the number of characters written.
|
|
|
|
+ fn chars_written(&self) -> usize {
|
|
|
|
+ 0
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+
|
|
|
|
+ /// Trait alias for a full-fledged console.
|
|
|
|
+ pub trait All = Write + Statistics;
|
|
|
|
}
|
|
|
|
|
|
|
|
diff -uNr 03_hacky_hello_world/src/main.rs 04_safe_globals/src/main.rs
|
|
|
|
--- 03_hacky_hello_world/src/main.rs
|
|
|
|
+++ 04_safe_globals/src/main.rs
|
|
|
|
@@ -106,6 +106,7 @@
|
|
|
|
|
|
|
|
#![feature(format_args_nl)]
|
|
|
|
#![feature(panic_info_message)]
|
|
|
|
+#![feature(trait_alias)]
|
|
|
|
#![no_main]
|
|
|
|
#![no_std]
|
|
|
|
|
|
|
|
@@ -114,6 +115,7 @@
|
|
|
|
mod cpu;
|
|
|
|
mod panic_wait;
|
|
|
|
mod print;
|
|
|
|
+mod synchronization;
|
|
|
|
|
|
|
|
/// Early init code.
|
|
|
|
///
|
|
|
|
@@ -121,7 +123,15 @@
|
|
|
|
///
|
|
|
|
/// - Only a single core must be active and running this function.
|
|
|
|
unsafe fn kernel_init() -> ! {
|
|
|
|
- println!("Hello from Rust!");
|
|
|
|
+ use console::interface::Statistics;
|
|
|
|
|
|
|
|
- panic!("Stopping here.")
|
|
|
|
+ println!("[0] Hello from Rust!");
|
|
|
|
+
|
|
|
|
+ println!(
|
|
|
|
+ "[1] Chars written: {}",
|
|
|
|
+ bsp::console::console().chars_written()
|
|
|
|
+ );
|
|
|
|
+
|
|
|
|
+ println!("[2] Stopping here.");
|
|
|
|
+ cpu::wait_forever()
|
|
|
|
}
|
|
|
|
|
|
|
|
diff -uNr 03_hacky_hello_world/src/synchronization.rs 04_safe_globals/src/synchronization.rs
|
|
|
|
--- 03_hacky_hello_world/src/synchronization.rs
|
|
|
|
+++ 04_safe_globals/src/synchronization.rs
|
|
|
|
@@ -0,0 +1,77 @@
|
|
|
|
+// SPDX-License-Identifier: MIT OR Apache-2.0
|
|
|
|
+//
|
|
|
|
+// Copyright (c) 2020-2022 Andre Richter <andre.o.richter@gmail.com>
|
|
|
|
+
|
|
|
|
+//! Synchronization primitives.
|
|
|
|
+//!
|
|
|
|
+//! # Resources
|
|
|
|
+//!
|
|
|
|
+//! - <https://doc.rust-lang.org/book/ch16-04-extensible-concurrency-sync-and-send.html>
|
|
|
|
+//! - <https://stackoverflow.com/questions/59428096/understanding-the-send-trait>
|
|
|
|
+//! - <https://doc.rust-lang.org/std/cell/index.html>
|
|
|
|
+
|
|
|
|
+use core::cell::UnsafeCell;
|
|
|
|
+
|
|
|
|
+//--------------------------------------------------------------------------------------------------
|
|
|
|
+// Public Definitions
|
|
|
|
+//--------------------------------------------------------------------------------------------------
|
|
|
|
+
|
|
|
|
+/// Synchronization interfaces.
|
|
|
|
+pub mod interface {
|
|
|
|
+
|
|
|
|
+ /// Any object implementing this trait guarantees exclusive access to the data wrapped within
|
|
|
|
+ /// the Mutex for the duration of the provided closure.
|
|
|
|
+ pub trait Mutex {
|
|
|
|
+ /// The type of the data that is wrapped by this mutex.
|
|
|
|
+ type Data;
|
|
|
|
+
|
|
|
|
+ /// Locks the mutex and grants the closure temporary mutable access to the wrapped data.
|
|
|
|
+ fn lock<R>(&self, f: impl FnOnce(&mut Self::Data) -> R) -> R;
|
|
|
|
+ }
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+/// A pseudo-lock for teaching purposes.
|
|
|
|
+///
|
|
|
|
+/// In contrast to a real Mutex implementation, does not protect against concurrent access from
|
|
|
|
+/// other cores to the contained data. This part is preserved for later lessons.
|
|
|
|
+///
|
|
|
|
+/// The lock will only be used as long as it is safe to do so, i.e. as long as the kernel is
|
|
|
|
+/// executing single-threaded, aka only running on a single core with interrupts disabled.
|
|
|
|
+pub struct NullLock<T>
|
|
|
|
+where
|
|
|
|
+ T: ?Sized,
|
|
|
|
+{
|
|
|
|
+ data: UnsafeCell<T>,
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+//--------------------------------------------------------------------------------------------------
|
|
|
|
+// Public Code
|
|
|
|
+//--------------------------------------------------------------------------------------------------
|
|
|
|
+
|
|
|
|
+unsafe impl<T> Send for NullLock<T> where T: ?Sized + Send {}
|
|
|
|
+unsafe impl<T> Sync for NullLock<T> where T: ?Sized + Send {}
|
|
|
|
+
|
|
|
|
+impl<T> NullLock<T> {
|
|
|
|
+ /// Create an instance.
|
|
|
|
+ pub const fn new(data: T) -> Self {
|
|
|
|
+ Self {
|
|
|
|
+ data: UnsafeCell::new(data),
|
|
|
|
+ }
|
|
|
|
+ }
|
|
|
|
+}
|
|
|
|
+
|
|
|
|
+//------------------------------------------------------------------------------
|
|
|
|
+// OS Interface Code
|
|
|
|
+//------------------------------------------------------------------------------
|
|
|
|
+
|
|
|
|
+impl<T> interface::Mutex for NullLock<T> {
|
|
|
|
+ type Data = T;
|
|
|
|
+
|
|
|
|
+ fn lock<R>(&self, f: impl FnOnce(&mut Self::Data) -> R) -> R {
|
|
|
|
+ // In a real lock, there would be code encapsulating this line that ensures that this
|
|
|
|
+ // mutable reference will ever only be given out once at a time.
|
|
|
|
+ let data = unsafe { &mut *self.data.get() };
|
|
|
|
+
|
|
|
|
+ f(data)
|
|
|
|
+ }
|
|
|
|
+}
|
|
|
|
|
|
|
|
```
|